C18H20N4O3S — CID 166286718
10-[3-[3-(4,5-dihydro-1,2-oxazol-3-yl)azetidin-1-yl]-3-oxopropyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 166286718) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 10-[3-[3-(4,5-dihydro-1,2-oxazol-3-yl)azetidin-1-yl]-3-oxopropyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[3-[3-(4,5-dihydro-1,2-oxazol-3-yl)azetidin-1-yl]-3-oxopropyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 166286718 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 10-[3-[3-(4,5-dihydro-1,2-oxazol-3-yl)azetidin-1-yl]-3-oxopropyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | O=C(CCc1nc2sc3c(c2c(=O)[nH]1)CCC3)N1CC(C2=NOCC2)C1 |
| InChI | InChI=1S/C18H20N4O3S/c23-15(22-8-10(9-22)12-6-7-25-21-12)5-4-14-19-17(24)16-11-2-1-3-13(11)26-18(16)20-14/h10H,1-9H2,(H,19,20,24) |
| InChIKey | CCMLNTOVNVRBBE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |