C15H24N2O3 — CID 166286980
3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpropane-1,2-diol (PubChem CID 166286980) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpropane-1,2-diol.
| Compound Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 166286980 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpropane-1,2-diol |
| SMILES | COc1ccccc1N1CCN(CC(C)(O)CO)CC1 |
| InChI | InChI=1S/C15H24N2O3/c1-15(19,12-18)11-16-7-9-17(10-8-16)13-5-3-4-6-14(13)20-2/h3-6,18-19H,7-12H2,1-2H3 |
| InChIKey | UEBSFOCUUCMVDT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |