About N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine
N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine (PubChem CID 166287571) has the molecular formula C14H19F2NO
and a molecular weight of 255.31 g/mol. Its IUPAC name is N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine |
| PubChem CID | 166287571 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine |
| SMILES | Cc1ccc(C(C)NCC2C3CCC(F)(F)C32)o1 |
| InChI | InChI=1S/C14H19F2NO/c1-8-3-4-12(18-8)9(2)17-7-11-10-5-6-14(15,16)13(10)11/h3-4,9-11,13,17H,5-7H2,1-2H3 |
| InChIKey | LRNNULLDRARFLL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine?
The IUPAC name of N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine (CID 166287571) is N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine.
What is the SMILES notation for N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine?
The canonical SMILES for N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine is Cc1ccc(C(C)NCC2C3CCC(F)(F)C32)o1.
What is the InChIKey of N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine?
The InChIKey is LRNNULLDRARFLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO/c1-8-3-4-12(18-8)9(2)17-7-11-10-5-6-14(15,16)13(10)11/h3-4,9-11,13,17H,5-7H2,1-2H3.
What are the key properties of N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine?
N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine has a molecular weight of 255.31 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-difluoro-6-bicyclo[3.1.0]hexanyl)methyl]-1-(5-methylfuran-2-yl)ethanamine is sourced from PubChem (CID 166287571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).