C19H22N4O3 — CID 166288184
N-[[1-(2-methylphenyl)cyclopropyl]methyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide (PubChem CID 166288184) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[[1-(2-methylphenyl)cyclopropyl]methyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide.
| Compound Name | N-[[1-(2-methylphenyl)cyclopropyl]methyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 166288184 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[[1-(2-methylphenyl)cyclopropyl]methyl]-2,4-dioxo-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxamide |
| SMILES | Cc1ccccc1C1(CNC(=O)N2CCc3c([nH]c(=O)[nH]c3=O)C2)CC1 |
| InChI | InChI=1S/C19H22N4O3/c1-12-4-2-3-5-14(12)19(7-8-19)11-20-18(26)23-9-6-13-15(10-23)21-17(25)22-16(13)24/h2-5H,6-11H2,1H3,(H,20,26)(H2,21,22,24,25) |
| InChIKey | ATYFSNCVGKWLQL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |