C17H25NO4 — CID 166289834
(1R,2R,4R,5R)-5-[[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 166289834) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (1R,2R,4R,5R)-5-[[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,4R,5R)-5-[[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 166289834 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (1R,2R,4R,5R)-5-[[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(N[C@@H]1C[C@H]2C[C@@H]1C[C@H]2C(=O)O)C1C[C@@H]2CCCC[C@H]2O1 |
| InChI | InChI=1S/C17H25NO4/c19-16(15-8-9-3-1-2-4-14(9)22-15)18-13-7-10-5-11(13)6-12(10)17(20)21/h9-15H,1-8H2,(H,18,19)(H,20,21)/t9-,10+,11+,12+,13+,14+,15?/m0/s1 |
| InChIKey | HGXVUCFUPOBEBD-BQFMPMMPSA-N |
| XLogP | 1.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |