C20H18N2O4S2 — CID 16628989
2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 16628989) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16628989 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[(5Z)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(CC(=O)Nc3ccccc3C)C2=O)ccc1O |
| InChI | InChI=1S/C20H18N2O4S2/c1-12-5-3-4-6-14(12)21-18(24)11-22-19(25)17(28-20(22)27)10-13-7-8-15(23)16(9-13)26-2/h3-10,23H,11H2,1-2H3,(H,21,24)/b17-10- |
| InChIKey | BYPJGHQAFYJECD-YVLHZVERSA-N |
| XLogP | 3.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|