C20H22F3N5O2 — CID 166290256
3-methyl-N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-4,5,6,7-tetrahydro-2H-indazol-6-amine;2,2,2-trifluoroacetic acid (PubChem CID 166290256) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 3-methyl-N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-4,5,6,7-tetrahydro-2H-indazol-6-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-methyl-N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-4,5,6,7-tetrahydro-2H-indazol-6-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166290256 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-methyl-N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-4,5,6,7-tetrahydro-2H-indazol-6-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1[nH]nc2c1CCC(NCc1cccc(-c3ccn[nH]3)c1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N5.C2HF3O2/c1-12-16-6-5-15(10-18(16)23-21-12)19-11-13-3-2-4-14(9-13)17-7-8-20-22-17;3-2(4,5)1(6)7/h2-4,7-9,15,19H,5-6,10-11H2,1H3,(H,20,22)(H,21,23);(H,6,7) |
| InChIKey | MKGFYTJUIJBQPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |