C12H17N3O2S — CID 166291272
N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-1H-imidazole-2-sulfonamide (PubChem CID 166291272) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-1H-imidazole-2-sulfonamide.
| Compound Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-1H-imidazole-2-sulfonamide |
|---|---|
| PubChem CID | 166291272 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]ethyl]-1H-imidazole-2-sulfonamide |
| SMILES | O=S(=O)(NCC[C@@H]1C[C@@H]2C=C[C@H]1C2)c1ncc[nH]1 |
| InChI | InChI=1S/C12H17N3O2S/c16-18(17,12-13-5-6-14-12)15-4-3-11-8-9-1-2-10(11)7-9/h1-2,5-6,9-11,15H,3-4,7-8H2,(H,13,14)/t9-,10+,11-/m1/s1 |
| InChIKey | HDQGPTWDMNQQKP-OUAUKWLOSA-N |
| XLogP | 1.29 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|