About 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane
4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane (PubChem CID 166291470) has the molecular formula C19H22N4S
and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane |
| PubChem CID | 166291470 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane |
| SMILES | c1ccc2cc(-n3cc(CCN4CCCSCC4)nn3)ccc2c1 |
| InChI | InChI=1S/C19H22N4S/c1-2-5-17-14-19(7-6-16(17)4-1)23-15-18(20-21-23)8-10-22-9-3-12-24-13-11-22/h1-2,4-7,14-15H,3,8-13H2 |
| InChIKey | GUXNUSCBZBYINX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane?
The IUPAC name of 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane (CID 166291470) is 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane.
What is the SMILES notation for 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane?
The canonical SMILES for 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane is c1ccc2cc(-n3cc(CCN4CCCSCC4)nn3)ccc2c1.
What is the InChIKey of 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane?
The InChIKey is GUXNUSCBZBYINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4S/c1-2-5-17-14-19(7-6-16(17)4-1)23-15-18(20-21-23)8-10-22-9-3-12-24-13-11-22/h1-2,4-7,14-15H,3,8-13H2.
What are the key properties of 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane?
4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane has a molecular weight of 338.48 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-naphthalen-2-yltriazol-4-yl)ethyl]-1,4-thiazepane is sourced from PubChem (CID 166291470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).