C17H19ClN2O2 — CID 166292208
(1R,2S,3R,4R,5S)-5-[[(8-chloroquinolin-2-yl)amino]methyl]bicyclo[2.2.1]heptane-2,3-diol (PubChem CID 166292208) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S)-5-[[(8-chloroquinolin-2-yl)amino]methyl]bicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | (1R,2S,3R,4R,5S)-5-[[(8-chloroquinolin-2-yl)amino]methyl]bicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 166292208 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (1R,2S,3R,4R,5S)-5-[[(8-chloroquinolin-2-yl)amino]methyl]bicyclo[2.2.1]heptane-2,3-diol |
| SMILES | O[C@H]1[C@@H]2C[C@H](CNc3ccc4cccc(Cl)c4n3)[C@@H](C2)[C@H]1O |
| InChI | InChI=1S/C17H19ClN2O2/c18-13-3-1-2-9-4-5-14(20-15(9)13)19-8-11-6-10-7-12(11)17(22)16(10)21/h1-5,10-12,16-17,21-22H,6-8H2,(H,19,20)/t10-,11-,12-,16+,17-/m1/s1 |
| InChIKey | NGJNRFCOVTXJJI-CDXAIKFWSA-N |
| XLogP | 2.68 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |