C20H26FNO3 — CID 166292539
2-[3-[[1-[(4-fluorophenyl)methyl]cyclohexyl]carbamoyl]cyclobutyl]acetic acid (PubChem CID 166292539) has the molecular formula C20H26FNO3 and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-[3-[[1-[(4-fluorophenyl)methyl]cyclohexyl]carbamoyl]cyclobutyl]acetic acid.
| Compound Name | 2-[3-[[1-[(4-fluorophenyl)methyl]cyclohexyl]carbamoyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 166292539 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-[3-[[1-[(4-fluorophenyl)methyl]cyclohexyl]carbamoyl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1CC(C(=O)NC2(Cc3ccc(F)cc3)CCCCC2)C1 |
| InChI | InChI=1S/C20H26FNO3/c21-17-6-4-14(5-7-17)13-20(8-2-1-3-9-20)22-19(25)16-10-15(11-16)12-18(23)24/h4-7,15-16H,1-3,8-13H2,(H,22,25)(H,23,24) |
| InChIKey | HNDAJRQUAASUID-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |