C16H16FN3O3 — CID 166292608
N-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-4-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 166292608) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is N-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-4-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-4-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 166292608 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]-4-(hydroxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccccc2F)on1)N1CC=C(CO)CC1 |
| InChI | InChI=1S/C16H16FN3O3/c17-13-4-2-1-3-12(13)14-9-15(19-23-14)18-16(22)20-7-5-11(10-21)6-8-20/h1-5,9,21H,6-8,10H2,(H,18,19,22) |
| InChIKey | HALNUUUUJZIPPJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|