C11H17N5O — CID 166293233
2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methylcyclohex-2-en-1-yl)acetamide (PubChem CID 166293233) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methylcyclohex-2-en-1-yl)acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methylcyclohex-2-en-1-yl)acetamide |
|---|---|
| PubChem CID | 166293233 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-(3-methylcyclohex-2-en-1-yl)acetamide |
| SMILES | CC1=CC(NC(=O)Cn2cnc(N)n2)CCC1 |
| InChI | InChI=1S/C11H17N5O/c1-8-3-2-4-9(5-8)14-10(17)6-16-7-13-11(12)15-16/h5,7,9H,2-4,6H2,1H3,(H2,12,15)(H,14,17) |
| InChIKey | XLVPGKGHNCZLJV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|