C10H13FN2O4S2 — CID 166293292
4-(5-fluorothiophen-2-yl)sulfonyl-1-methylpiperazine-2-carboxylic acid (PubChem CID 166293292) has the molecular formula C10H13FN2O4S2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-(5-fluorothiophen-2-yl)sulfonyl-1-methylpiperazine-2-carboxylic acid.
| Compound Name | 4-(5-fluorothiophen-2-yl)sulfonyl-1-methylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 166293292 |
| Molecular Formula | C10H13FN2O4S2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 4-(5-fluorothiophen-2-yl)sulfonyl-1-methylpiperazine-2-carboxylic acid |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(F)s2)CC1C(=O)O |
| InChI | InChI=1S/C10H13FN2O4S2/c1-12-4-5-13(6-7(12)10(14)15)19(16,17)9-3-2-8(11)18-9/h2-3,7H,4-6H2,1H3,(H,14,15) |
| InChIKey | NWDJANRDKBLGNA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |