About [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol
[4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol (PubChem CID 166293633) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol |
| PubChem CID | 166293633 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol |
| SMILES | Cc1ccc2c(c1)c(CCNc1cc(C)nc(CO)n1)cn2C |
| InChI | InChI=1S/C18H22N4O/c1-12-4-5-16-15(8-12)14(10-22(16)3)6-7-19-17-9-13(2)20-18(11-23)21-17/h4-5,8-10,23H,6-7,11H2,1-3H3,(H,19,20,21) |
| InChIKey | LZYGMMOMISJKBD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol?
The IUPAC name of [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol (CID 166293633) is [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol.
What is the SMILES notation for [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol?
The canonical SMILES for [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol is Cc1ccc2c(c1)c(CCNc1cc(C)nc(CO)n1)cn2C.
What is the InChIKey of [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol?
The InChIKey is LZYGMMOMISJKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O/c1-12-4-5-16-15(8-12)14(10-22(16)3)6-7-19-17-9-13(2)20-18(11-23)21-17/h4-5,8-10,23H,6-7,11H2,1-3H3,(H,19,20,21).
What are the key properties of [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol?
[4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol has a molecular weight of 310.40 g/mol, XLogP of 2.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(1,5-dimethylindol-3-yl)ethylamino]-6-methylpyrimidin-2-yl]methanol is sourced from PubChem (CID 166293633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).