About 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide
2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide (PubChem CID 166293646) has the molecular formula C14H20N6O
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide |
| PubChem CID | 166293646 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide |
| SMILES | Cn1cnc2c(N3CC(C)(C)CC3CC(N)=O)ncnc21 |
| InChI | InChI=1S/C14H20N6O/c1-14(2)5-9(4-10(15)21)20(6-14)13-11-12(16-7-17-13)19(3)8-18-11/h7-9H,4-6H2,1-3H3,(H2,15,21) |
| InChIKey | XWTSSRJZVMSVKD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide?
The IUPAC name of 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide (CID 166293646) is 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide.
What is the SMILES notation for 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide?
The canonical SMILES for 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide is Cn1cnc2c(N3CC(C)(C)CC3CC(N)=O)ncnc21.
What is the InChIKey of 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide?
The InChIKey is XWTSSRJZVMSVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6O/c1-14(2)5-9(4-10(15)21)20(6-14)13-11-12(16-7-17-13)19(3)8-18-11/h7-9H,4-6H2,1-3H3,(H2,15,21).
What are the key properties of 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide?
2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide has a molecular weight of 288.35 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,4-dimethyl-1-(9-methylpurin-6-yl)pyrrolidin-2-yl]acetamide is sourced from PubChem (CID 166293646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).