C19H25N3O3 — CID 166294036
methyl 4-[(2-tert-butyloxan-4-yl)amino]quinazoline-6-carboxylate (PubChem CID 166294036) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is methyl 4-[(2-tert-butyloxan-4-yl)amino]quinazoline-6-carboxylate.
| Compound Name | methyl 4-[(2-tert-butyloxan-4-yl)amino]quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 166294036 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | methyl 4-[(2-tert-butyloxan-4-yl)amino]quinazoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2ncnc(NC3CCOC(C(C)(C)C)C3)c2c1 |
| InChI | InChI=1S/C19H25N3O3/c1-19(2,3)16-10-13(7-8-25-16)22-17-14-9-12(18(23)24-4)5-6-15(14)20-11-21-17/h5-6,9,11,13,16H,7-8,10H2,1-4H3,(H,20,21,22) |
| InChIKey | RANZZIRGOGCGFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |