About (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid
(3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid (PubChem CID 166294778) has the molecular formula C11H12ClF2NO4S
and a molecular weight of 327.74 g/mol. Its IUPAC name is (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid.
Molecular Properties
| Compound Name | (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid |
| PubChem CID | 166294778 |
| Molecular Formula | C11H12ClF2NO4S |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid |
| SMILES | CC[C@@H](CC(=O)O)NS(=O)(=O)c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C11H12ClF2NO4S/c1-2-6(3-11(16)17)15-20(18,19)10-4-7(12)8(13)5-9(10)14/h4-6,15H,2-3H2,1H3,(H,16,17)/t6-/m0/s1 |
| InChIKey | ALJIMWWBMVVVLF-LURJTMIESA-N |
| XLogP | 2.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid?
The IUPAC name of (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid (CID 166294778) is (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid.
What is the SMILES notation for (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid?
The canonical SMILES for (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid is CC[C@@H](CC(=O)O)NS(=O)(=O)c1cc(Cl)c(F)cc1F.
What is the InChIKey of (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid?
The InChIKey is ALJIMWWBMVVVLF-LURJTMIESA-N. The full InChI is InChI=1S/C11H12ClF2NO4S/c1-2-6(3-11(16)17)15-20(18,19)10-4-7(12)8(13)5-9(10)14/h4-6,15H,2-3H2,1H3,(H,16,17)/t6-/m0/s1.
What are the key properties of (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid?
(3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid has a molecular weight of 327.74 g/mol, XLogP of 2.15, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(5-chloro-2,4-difluorophenyl)sulfonylamino]pentanoic acid is sourced from PubChem (CID 166294778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).