About 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane
3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane (PubChem CID 166295319) has the molecular formula C12H12F2O
and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane.
Molecular Properties
| Compound Name | 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane |
| PubChem CID | 166295319 |
| Molecular Formula | C12H12F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane |
| SMILES | Fc1cc(F)cc(/C=C/C2CCOC2)c1 |
| InChI | InChI=1S/C12H12F2O/c13-11-5-10(6-12(14)7-11)2-1-9-3-4-15-8-9/h1-2,5-7,9H,3-4,8H2/b2-1+ |
| InChIKey | XTSPZIDZKOXOBH-OWOJBTEDSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane?
The IUPAC name of 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane (CID 166295319) is 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane.
What is the SMILES notation for 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane?
The canonical SMILES for 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane is Fc1cc(F)cc(/C=C/C2CCOC2)c1.
What is the InChIKey of 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane?
The InChIKey is XTSPZIDZKOXOBH-OWOJBTEDSA-N. The full InChI is InChI=1S/C12H12F2O/c13-11-5-10(6-12(14)7-11)2-1-9-3-4-15-8-9/h1-2,5-7,9H,3-4,8H2/b2-1+.
What are the key properties of 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane?
3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane has a molecular weight of 210.22 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(3,5-difluorophenyl)ethenyl]oxolane is sourced from PubChem (CID 166295319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).