About 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid
1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid (PubChem CID 166295357) has the molecular formula C17H25F2N3O2
and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid |
| PubChem CID | 166295357 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid |
| SMILES | O=C(O)C1CCC2(CCCCC2)N(Cc2ccnn2CC(F)F)C1 |
| InChI | InChI=1S/C17H25F2N3O2/c18-15(19)12-22-14(5-9-20-22)11-21-10-13(16(23)24)4-8-17(21)6-2-1-3-7-17/h5,9,13,15H,1-4,6-8,10-12H2,(H,23,24) |
| InChIKey | TWUIIZJQXHARFP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid?
The IUPAC name of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid (CID 166295357) is 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid.
What is the SMILES notation for 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid?
The canonical SMILES for 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid is O=C(O)C1CCC2(CCCCC2)N(Cc2ccnn2CC(F)F)C1.
What is the InChIKey of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid?
The InChIKey is TWUIIZJQXHARFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2N3O2/c18-15(19)12-22-14(5-9-20-22)11-21-10-13(16(23)24)4-8-17(21)6-2-1-3-7-17/h5,9,13,15H,1-4,6-8,10-12H2,(H,23,24).
What are the key properties of 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid?
1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid has a molecular weight of 341.40 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2,2-difluoroethyl)pyrazol-3-yl]methyl]-1-azaspiro[5.5]undecane-3-carboxylic acid is sourced from PubChem (CID 166295357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).