C13H13BrClNO3 — CID 166295968
3-(7-bromo-5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-oxopropanoic acid (PubChem CID 166295968) has the molecular formula C13H13BrClNO3 and a molecular weight of 346.61 g/mol. Its IUPAC name is 3-(7-bromo-5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-(7-bromo-5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 166295968 |
| Molecular Formula | C13H13BrClNO3 |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 3-(7-bromo-5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1CCc2c(Cl)cc(Br)cc2C1 |
| InChI | InChI=1S/C13H13BrClNO3/c1-7(13(18)19)12(17)16-3-2-10-8(6-16)4-9(14)5-11(10)15/h4-5,7H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | HHUFYFRTGIVQFP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|