C16H23F2N3O2 — CID 166296419
2-(5,5-difluorooxan-2-yl)-1-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone (PubChem CID 166296419) has the molecular formula C16H23F2N3O2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-(5,5-difluorooxan-2-yl)-1-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone.
| Compound Name | 2-(5,5-difluorooxan-2-yl)-1-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone |
|---|---|
| PubChem CID | 166296419 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(5,5-difluorooxan-2-yl)-1-(7,7-dimethyl-1,4,6,8-tetrahydropyrazolo[4,5-c]azepin-5-yl)ethanone |
| SMILES | CC1(C)Cc2[nH]ncc2CN(C(=O)CC2CCC(F)(F)CO2)C1 |
| InChI | InChI=1S/C16H23F2N3O2/c1-15(2)6-13-11(7-19-20-13)8-21(9-15)14(22)5-12-3-4-16(17,18)10-23-12/h7,12H,3-6,8-10H2,1-2H3,(H,19,20) |
| InChIKey | HUGDXFBGURTLNR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |