About N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide
N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide (PubChem CID 166297377) has the molecular formula C17H29N3O4
and a molecular weight of 339.44 g/mol. Its IUPAC name is N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide.
Molecular Properties
| Compound Name | N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide |
| PubChem CID | 166297377 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide |
| SMILES | CNC(=O)CCCC(=O)N(CCNC(=O)C1(C)CCOC1)C1CC1 |
| InChI | InChI=1S/C17H29N3O4/c1-17(8-11-24-12-17)16(23)19-9-10-20(13-6-7-13)15(22)5-3-4-14(21)18-2/h13H,3-12H2,1-2H3,(H,18,21)(H,19,23) |
| InChIKey | IQBVQSQMOJHVBZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide?
The IUPAC name of N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide (CID 166297377) is N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide.
What is the SMILES notation for N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide?
The canonical SMILES for N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide is CNC(=O)CCCC(=O)N(CCNC(=O)C1(C)CCOC1)C1CC1.
What is the InChIKey of N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide?
The InChIKey is IQBVQSQMOJHVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O4/c1-17(8-11-24-12-17)16(23)19-9-10-20(13-6-7-13)15(22)5-3-4-14(21)18-2/h13H,3-12H2,1-2H3,(H,18,21)(H,19,23).
What are the key properties of N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide?
N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide has a molecular weight of 339.44 g/mol, XLogP of 0.44, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N-methyl-N'-[2-[(3-methyloxolane-3-carbonyl)amino]ethyl]pentanediamide is sourced from PubChem (CID 166297377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).