About 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol
2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol (PubChem CID 166298271) has the molecular formula C15H16BrN3O2
and a molecular weight of 350.22 g/mol. Its IUPAC name is 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol |
| PubChem CID | 166298271 |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol |
| SMILES | OCC(Cc1ccoc1)NCc1cnc2cc(Br)ccn12 |
| InChI | InChI=1S/C15H16BrN3O2/c16-12-1-3-19-14(8-18-15(19)6-12)7-17-13(9-20)5-11-2-4-21-10-11/h1-4,6,8,10,13,17,20H,5,7,9H2 |
| InChIKey | DOJPDPIDMREUQL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol?
The IUPAC name of 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol (CID 166298271) is 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol.
What is the SMILES notation for 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol?
The canonical SMILES for 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol is OCC(Cc1ccoc1)NCc1cnc2cc(Br)ccn12.
What is the InChIKey of 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol?
The InChIKey is DOJPDPIDMREUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrN3O2/c16-12-1-3-19-14(8-18-15(19)6-12)7-17-13(9-20)5-11-2-4-21-10-11/h1-4,6,8,10,13,17,20H,5,7,9H2.
What are the key properties of 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol?
2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol has a molecular weight of 350.22 g/mol, XLogP of 2.38, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-bromoimidazo[1,2-a]pyridin-3-yl)methylamino]-3-(furan-3-yl)propan-1-ol is sourced from PubChem (CID 166298271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).