C16H20F5N3O3 — CID 166298474
[5-(difluoromethyl)-1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-4-yl]-(4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone (PubChem CID 166298474) has the molecular formula C16H20F5N3O3 and a molecular weight of 397.34 g/mol. Its IUPAC name is [5-(difluoromethyl)-1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-4-yl]-(4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone.
| Compound Name | [5-(difluoromethyl)-1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-4-yl]-(4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 166298474 |
| Molecular Formula | C16H20F5N3O3 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [5-(difluoromethyl)-1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrazol-4-yl]-(4-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone |
| SMILES | O=C(c1c(C(F)(F)F)nn(CCO)c1C(F)F)N1CC2CCCC(O)C2C1 |
| InChI | InChI=1S/C16H20F5N3O3/c17-14(18)12-11(13(16(19,20)21)22-24(12)4-5-25)15(27)23-6-8-2-1-3-10(26)9(8)7-23/h8-10,14,25-26H,1-7H2 |
| InChIKey | KJGJCSIGUCHVAW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |