C17H22N4OS — CID 166298535
N-piperidin-4-yl-N-propyl-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 166298535) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N-piperidin-4-yl-N-propyl-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-piperidin-4-yl-N-propyl-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166298535 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-piperidin-4-yl-N-propyl-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCCN(C(=O)c1csc(-c2ccncc2)n1)C1CCNCC1 |
| InChI | InChI=1S/C17H22N4OS/c1-2-11-21(14-5-9-19-10-6-14)17(22)15-12-23-16(20-15)13-3-7-18-8-4-13/h3-4,7-8,12,14,19H,2,5-6,9-11H2,1H3 |
| InChIKey | MHDOCODWTDRSMB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |