C15H14N2O5S2 — CID 16629896
2-[3-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetic acid (PubChem CID 16629896) has the molecular formula C15H14N2O5S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[3-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetic acid.
| Compound Name | 2-[3-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 16629896 |
| Molecular Formula | C15H14N2O5S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 2-[3-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)CCN1C(=O)/C(=C/c2cccc(O)c2)SC1=S |
| InChI | InChI=1S/C15H14N2O5S2/c18-10-3-1-2-9(6-10)7-11-14(22)17(15(23)24-11)5-4-12(19)16-8-13(20)21/h1-3,6-7,18H,4-5,8H2,(H,16,19)(H,20,21)/b11-7- |
| InChIKey | KORCQVPDOAITHP-XFFZJAGNSA-N |
| XLogP | 1.18 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|