C16H20N4O2 — CID 166299163
(3S)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]morpholine-3-carboxamide (PubChem CID 166299163) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3S)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]morpholine-3-carboxamide.
| Compound Name | (3S)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 166299163 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3S)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]morpholine-3-carboxamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)[C@@H]3COCCN3)cc2)c1C |
| InChI | InChI=1S/C16H20N4O2/c1-11-12(2)20(10-18-11)14-5-3-13(4-6-14)19-16(21)15-9-22-8-7-17-15/h3-6,10,15,17H,7-9H2,1-2H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | GLSJYEHKSFCWRY-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |