C18H23N5O2 — CID 166299269
N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide (PubChem CID 166299269) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide.
| Compound Name | N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166299269 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxamide |
| SMILES | O=C(NC[C@@H](O)CN1CCc2ccccc2C1)C1NCc2[nH]ncc21 |
| InChI | InChI=1S/C18H23N5O2/c24-14(11-23-6-5-12-3-1-2-4-13(12)10-23)7-20-18(25)17-15-8-21-22-16(15)9-19-17/h1-4,8,14,17,19,24H,5-7,9-11H2,(H,20,25)(H,21,22)/t14-,17?/m1/s1 |
| InChIKey | SEXTUFVRYAIUMP-XPCCGILXSA-N |
| XLogP | 0.09 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |