C19H20N6O — CID 166299507
5-(1,4-diazepan-1-yl)-N-quinolin-7-ylpyrazine-2-carboxamide (PubChem CID 166299507) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-N-quinolin-7-ylpyrazine-2-carboxamide.
| Compound Name | 5-(1,4-diazepan-1-yl)-N-quinolin-7-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 166299507 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-N-quinolin-7-ylpyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc2cccnc2c1)c1cnc(N2CCCNCC2)cn1 |
| InChI | InChI=1S/C19H20N6O/c26-19(24-15-5-4-14-3-1-7-21-16(14)11-15)17-12-23-18(13-22-17)25-9-2-6-20-8-10-25/h1,3-5,7,11-13,20H,2,6,8-10H2,(H,24,26) |
| InChIKey | DJCMCSMLHZANER-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |