C18H21N3O4 — CID 166299853
5-[methoxy(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 166299853) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 5-[methoxy(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[methoxy(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166299853 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 5-[methoxy(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamoyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | CON(CC1CCCc2ccccc21)C(=O)c1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C18H21N3O4/c1-20-16(15(10-19-20)18(23)24)17(22)21(25-2)11-13-8-5-7-12-6-3-4-9-14(12)13/h3-4,6,9-10,13H,5,7-8,11H2,1-2H3,(H,23,24) |
| InChIKey | WMIGTKMXPVTNDO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|