C17H18FN5 — CID 166300470
5-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-2-fluorobenzonitrile (PubChem CID 166300470) has the molecular formula C17H18FN5 and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 166300470 |
| Molecular Formula | C17H18FN5 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 5-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(NC3CCC(N)CC3)n2)ccc1F |
| InChI | InChI=1S/C17H18FN5/c18-15-6-1-11(9-12(15)10-19)16-7-8-21-17(23-16)22-14-4-2-13(20)3-5-14/h1,6-9,13-14H,2-5,20H2,(H,21,22,23) |
| InChIKey | PHTKKDIRNBWVKY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |