C17H25N3O3 — CID 166301157
1-cyclobutyl-N-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-methylpyrazole-4-carboxamide (PubChem CID 166301157) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-cyclobutyl-N-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-methylpyrazole-4-carboxamide.
| Compound Name | 1-cyclobutyl-N-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166301157 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-cyclobutyl-N-[[(1S,2R,4S,5R,6S)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methyl]-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C2CCC2)cc1C(=O)NC[C@@H]1C[C@H]2C[C@@H]1[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C17H25N3O3/c1-9-14(8-20(19-9)12-3-2-4-12)17(23)18-7-11-5-10-6-13(11)16(22)15(10)21/h8,10-13,15-16,21-22H,2-7H2,1H3,(H,18,23)/t10-,11-,13-,15+,16-/m0/s1 |
| InChIKey | OMZRGZPTWYJVPX-LTDJIEQWSA-N |
| XLogP | 1.02 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |