About 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide
2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide (PubChem CID 166301952) has the molecular formula C16H17FN4O
and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide |
| PubChem CID | 166301952 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide |
| SMILES | N[C@@H]1C=C[C@H](CC(=O)Nc2cn[nH]c2-c2ccccc2F)C1 |
| InChI | InChI=1S/C16H17FN4O/c17-13-4-2-1-3-12(13)16-14(9-19-21-16)20-15(22)8-10-5-6-11(18)7-10/h1-6,9-11H,7-8,18H2,(H,19,21)(H,20,22)/t10-,11+/m0/s1 |
| InChIKey | WEMNKSDQPUZXLF-WDEREUQCSA-N |
| XLogP | 2.45 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide?
The IUPAC name of 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide (CID 166301952) is 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide.
What is the SMILES notation for 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide?
The canonical SMILES for 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide is N[C@@H]1C=C[C@H](CC(=O)Nc2cn[nH]c2-c2ccccc2F)C1.
What is the InChIKey of 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide?
The InChIKey is WEMNKSDQPUZXLF-WDEREUQCSA-N. The full InChI is InChI=1S/C16H17FN4O/c17-13-4-2-1-3-12(13)16-14(9-19-21-16)20-15(22)8-10-5-6-11(18)7-10/h1-6,9-11H,7-8,18H2,(H,19,21)(H,20,22)/t10-,11+/m0/s1.
What are the key properties of 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide?
2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide has a molecular weight of 300.34 g/mol, XLogP of 2.45, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[5-(2-fluorophenyl)-1H-pyrazol-4-yl]acetamide is sourced from PubChem (CID 166301952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).