C18H21N3O2 — CID 166303230
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-7-methoxyisoquinoline-3-carboxamide (PubChem CID 166303230) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-7-methoxyisoquinoline-3-carboxamide.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-7-methoxyisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 166303230 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl)-7-methoxyisoquinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NC3CC4CNCC4C3)ncc2c1 |
| InChI | InChI=1S/C18H21N3O2/c1-23-16-3-2-11-7-17(20-10-14(11)6-16)18(22)21-15-4-12-8-19-9-13(12)5-15/h2-3,6-7,10,12-13,15,19H,4-5,8-9H2,1H3,(H,21,22) |
| InChIKey | KGKBKXJXPGMQNY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |