C13H18FN3O3 — CID 166303471
2-(dimethylcarbamoylamino)oxy-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide (PubChem CID 166303471) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-(dimethylcarbamoylamino)oxy-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(dimethylcarbamoylamino)oxy-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 166303471 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(dimethylcarbamoylamino)oxy-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CONC(=O)N(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FN3O3/c1-9(10-4-6-11(14)7-5-10)15-12(18)8-20-16-13(19)17(2)3/h4-7,9H,8H2,1-3H3,(H,15,18)(H,16,19)/t9-/m1/s1 |
| InChIKey | LVLVZXBUVWWYBQ-SECBINFHSA-N |
| XLogP | 1.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|