C20H20F2N4O2 — CID 166303990
5-[1-(3,3-difluoro-4-hydroxybutyl)triazol-4-yl]-2-methyl-N-phenylbenzamide (PubChem CID 166303990) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is 5-[1-(3,3-difluoro-4-hydroxybutyl)triazol-4-yl]-2-methyl-N-phenylbenzamide.
| Compound Name | 5-[1-(3,3-difluoro-4-hydroxybutyl)triazol-4-yl]-2-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 166303990 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-[1-(3,3-difluoro-4-hydroxybutyl)triazol-4-yl]-2-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(-c2cn(CCC(F)(F)CO)nn2)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H20F2N4O2/c1-14-7-8-15(11-17(14)19(28)23-16-5-3-2-4-6-16)18-12-26(25-24-18)10-9-20(21,22)13-27/h2-8,11-12,27H,9-10,13H2,1H3,(H,23,28) |
| InChIKey | UQQCDOCDOPCPGA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |