C19H22FNO5 — CID 166304224
(3aS,5S,6aS)-4-[(2S,4R)-2-(3-fluorophenyl)oxane-4-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 166304224) has the molecular formula C19H22FNO5 and a molecular weight of 363.39 g/mol. Its IUPAC name is (3aS,5S,6aS)-4-[(2S,4R)-2-(3-fluorophenyl)oxane-4-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid.
| Compound Name | (3aS,5S,6aS)-4-[(2S,4R)-2-(3-fluorophenyl)oxane-4-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 166304224 |
| Molecular Formula | C19H22FNO5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (3aS,5S,6aS)-4-[(2S,4R)-2-(3-fluorophenyl)oxane-4-carbonyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H]2OCC[C@@H]2N1C(=O)[C@@H]1CCO[C@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H22FNO5/c20-13-3-1-2-11(8-13)16-9-12(4-6-25-16)18(22)21-14-5-7-26-17(14)10-15(21)19(23)24/h1-3,8,12,14-17H,4-7,9-10H2,(H,23,24)/t12-,14+,15+,16+,17+/m1/s1 |
| InChIKey | FHWLAZGBCACOQR-VFTHGPRRSA-N |
| XLogP | 2.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |