About N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide
N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide (PubChem CID 166304393) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide |
| PubChem CID | 166304393 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide |
| SMILES | Cn1cncc(C(=O)NC2CC(CN)C2(C)C)c1=O |
| InChI | InChI=1S/C13H20N4O2/c1-13(2)8(5-14)4-10(13)16-11(18)9-6-15-7-17(3)12(9)19/h6-8,10H,4-5,14H2,1-3H3,(H,16,18) |
| InChIKey | SHNMEGYBDWYPNZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide?
The IUPAC name of N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide (CID 166304393) is N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide.
What is the SMILES notation for N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide?
The canonical SMILES for N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide is Cn1cncc(C(=O)NC2CC(CN)C2(C)C)c1=O.
What is the InChIKey of N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide?
The InChIKey is SHNMEGYBDWYPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-13(2)8(5-14)4-10(13)16-11(18)9-6-15-7-17(3)12(9)19/h6-8,10H,4-5,14H2,1-3H3,(H,16,18).
What are the key properties of N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide?
N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide has a molecular weight of 264.33 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(aminomethyl)-2,2-dimethylcyclobutyl]-1-methyl-6-oxopyrimidine-5-carboxamide is sourced from PubChem (CID 166304393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).