C14H20ClN3O2 — CID 166304512
2-amino-5-chloro-N-[(2S,3S)-3-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide (PubChem CID 166304512) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[(2S,3S)-3-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-amino-5-chloro-N-[(2S,3S)-3-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 166304512 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-amino-5-chloro-N-[(2S,3S)-3-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cc(Cl)ccc1N)C(=O)NC |
| InChI | InChI=1S/C14H20ClN3O2/c1-4-8(2)12(14(20)17-3)18-13(19)10-7-9(15)5-6-11(10)16/h5-8,12H,4,16H2,1-3H3,(H,17,20)(H,18,19)/t8-,12-/m0/s1 |
| InChIKey | IUBUYVQKHURCFH-UFBFGSQYSA-N |
| XLogP | 1.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|