C17H21Cl2N7 — CID 166304610
2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-phenyl-7H-purin-6-amine;dihydrochloride (PubChem CID 166304610) has the molecular formula C17H21Cl2N7 and a molecular weight of 394.31 g/mol. Its IUPAC name is 2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-phenyl-7H-purin-6-amine;dihydrochloride.
| Compound Name | 2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-phenyl-7H-purin-6-amine;dihydrochloride |
|---|---|
| PubChem CID | 166304610 |
| Molecular Formula | C17H21Cl2N7 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-N-phenyl-7H-purin-6-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(Nc2nc(N3C[C@H]4CNC[C@H]4C3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C17H19N7.2ClH/c1-2-4-13(5-3-1)21-16-14-15(20-10-19-14)22-17(23-16)24-8-11-6-18-7-12(11)9-24;;/h1-5,10-12,18H,6-9H2,(H2,19,20,21,22,23);2*1H/t11-,12+;; |
| InChIKey | ILWNDFOLPBSNBA-FYPKGCJUSA-N |
| XLogP | 2.60 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |