C26H28N2O4S2 — CID 16630517
6-[4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid (PubChem CID 16630517) has the molecular formula C26H28N2O4S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is 6-[4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid.
| Compound Name | 6-[4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 16630517 |
| Molecular Formula | C26H28N2O4S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 6-[4-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCCN1C(=O)/C(=C/c2ccc(-c3ccccc3)cc2)SC1=S |
| InChI | InChI=1S/C26H28N2O4S2/c29-23(27-16-6-2-5-11-24(30)31)10-7-17-28-25(32)22(34-26(28)33)18-19-12-14-21(15-13-19)20-8-3-1-4-9-20/h1,3-4,8-9,12-15,18H,2,5-7,10-11,16-17H2,(H,27,29)(H,30,31)/b22-18- |
| InChIKey | VYNASOJXNUVKOR-PYCFMQQDSA-N |
| XLogP | 5.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|