About 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine
6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine (PubChem CID 166305739) has the molecular formula C15H21N5O
and a molecular weight of 287.37 g/mol. Its IUPAC name is 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine |
| PubChem CID | 166305739 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine |
| SMILES | CC(C)O[C@@H]1CCC[C@H]1n1cc(-c2cccc(N)n2)nn1 |
| InChI | InChI=1S/C15H21N5O/c1-10(2)21-14-7-4-6-13(14)20-9-12(18-19-20)11-5-3-8-15(16)17-11/h3,5,8-10,13-14H,4,6-7H2,1-2H3,(H2,16,17)/t13-,14-/m1/s1 |
| InChIKey | PTLIXHOCWMJVSD-ZIAGYGMSSA-N |
| XLogP | 2.44 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine?
The IUPAC name of 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine (CID 166305739) is 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine.
What is the SMILES notation for 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine?
The canonical SMILES for 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine is CC(C)O[C@@H]1CCC[C@H]1n1cc(-c2cccc(N)n2)nn1.
What is the InChIKey of 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine?
The InChIKey is PTLIXHOCWMJVSD-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H21N5O/c1-10(2)21-14-7-4-6-13(14)20-9-12(18-19-20)11-5-3-8-15(16)17-11/h3,5,8-10,13-14H,4,6-7H2,1-2H3,(H2,16,17)/t13-,14-/m1/s1.
What are the key properties of 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine?
6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine has a molecular weight of 287.37 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-[(1R,2R)-2-propan-2-yloxycyclopentyl]triazol-4-yl]pyridin-2-amine is sourced from PubChem (CID 166305739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).