C16H17N5O — CID 166306644
N-(4-pyridin-4-ylbutyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide (PubChem CID 166306644) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N-(4-pyridin-4-ylbutyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide.
| Compound Name | N-(4-pyridin-4-ylbutyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 166306644 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-(4-pyridin-4-ylbutyl)-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
| SMILES | O=C(NCCCCc1ccncc1)c1ccn2cnnc2c1 |
| InChI | InChI=1S/C16H17N5O/c22-16(14-6-10-21-12-19-20-15(21)11-14)18-7-2-1-3-13-4-8-17-9-5-13/h4-6,8-12H,1-3,7H2,(H,18,22) |
| InChIKey | SFQOJPCKKLLIJL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|