About 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one
5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one (PubChem CID 166307278) has the molecular formula C8H7ClF2N2O
and a molecular weight of 220.61 g/mol. Its IUPAC name is 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one |
| PubChem CID | 166307278 |
| Molecular Formula | C8H7ClF2N2O |
| Molecular Weight | 220.61 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one |
| SMILES | O=c1c(Cl)cncn1CC1CC1(F)F |
| InChI | InChI=1S/C8H7ClF2N2O/c9-6-2-12-4-13(7(6)14)3-5-1-8(5,10)11/h2,4-5H,1,3H2 |
| InChIKey | SXBUYTRQEFOLAB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.61 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one?
The IUPAC name of 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one (CID 166307278) is 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one.
What is the SMILES notation for 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one?
The canonical SMILES for 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one is O=c1c(Cl)cncn1CC1CC1(F)F.
What is the InChIKey of 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one?
The InChIKey is SXBUYTRQEFOLAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF2N2O/c9-6-2-12-4-13(7(6)14)3-5-1-8(5,10)11/h2,4-5H,1,3H2.
What are the key properties of 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one?
5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one has a molecular weight of 220.61 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[(2,2-difluorocyclopropyl)methyl]pyrimidin-4-one is sourced from PubChem (CID 166307278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).