C11H12FN3O3 — CID 166309332
N'-(2-fluorophenyl)-1-hydroxy-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 166309332) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-1-hydroxy-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N'-(2-fluorophenyl)-1-hydroxy-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 166309332 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N'-(2-fluorophenyl)-1-hydroxy-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | O=C(NNc1ccccc1F)C1CC(=O)N(O)C1 |
| InChI | InChI=1S/C11H12FN3O3/c12-8-3-1-2-4-9(8)13-14-11(17)7-5-10(16)15(18)6-7/h1-4,7,13,18H,5-6H2,(H,14,17) |
| InChIKey | KXFGHCQETBDTNT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|