C16H20FN3 — CID 166310142
N-[1-(4-fluorophenyl)-2-imidazol-1-ylethyl]-2-methylbut-3-en-1-amine (PubChem CID 166310142) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-imidazol-1-ylethyl]-2-methylbut-3-en-1-amine.
| Compound Name | N-[1-(4-fluorophenyl)-2-imidazol-1-ylethyl]-2-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 166310142 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-imidazol-1-ylethyl]-2-methylbut-3-en-1-amine |
| SMILES | C=CC(C)CNC(Cn1ccnc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN3/c1-3-13(2)10-19-16(11-20-9-8-18-12-20)14-4-6-15(17)7-5-14/h3-9,12-13,16,19H,1,10-11H2,2H3 |
| InChIKey | DURHBBAVGBCHLS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|