C16H18N6O — CID 166310595
6,8-dimethyl-N-(5-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-yl)pyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 166310595) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 6,8-dimethyl-N-(5-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-yl)pyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 6,8-dimethyl-N-(5-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-yl)pyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 166310595 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 6,8-dimethyl-N-(5-methyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-yl)pyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC(C)n3ncnc32)c(C)n2ccncc12 |
| InChI | InChI=1S/C16H18N6O/c1-9-6-12(15-18-8-19-22(9)15)20-16(23)14-10(2)13-7-17-4-5-21(13)11(14)3/h4-5,7-9,12H,6H2,1-3H3,(H,20,23) |
| InChIKey | NTGHDERUCGRMNA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |