C18H26N2O4S — CID 166310640
(1R,3S,5S,6S,7R)-6,7-dihydroxy-N-[5-(oxan-2-yl)-1,3-thiazol-2-yl]bicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 166310640) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is (1R,3S,5S,6S,7R)-6,7-dihydroxy-N-[5-(oxan-2-yl)-1,3-thiazol-2-yl]bicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | (1R,3S,5S,6S,7R)-6,7-dihydroxy-N-[5-(oxan-2-yl)-1,3-thiazol-2-yl]bicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 166310640 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (1R,3S,5S,6S,7R)-6,7-dihydroxy-N-[5-(oxan-2-yl)-1,3-thiazol-2-yl]bicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | O=C(Nc1ncc(C2CCCCO2)s1)[C@H]1C[C@H]2C[C@@H](C1)[C@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C18H26N2O4S/c21-13-7-10-5-11(16(13)22)8-12(6-10)17(23)20-18-19-9-15(25-18)14-3-1-2-4-24-14/h9-14,16,21-22H,1-8H2,(H,19,20,23)/t10-,11+,12+,13-,14?,16+/m1/s1 |
| InChIKey | ZHJGNIRNMIZXGB-REUQXBMSSA-N |
| XLogP | 2.48 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |