About 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one
1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one (PubChem CID 166311911) has the molecular formula C16H18BrN5O
and a molecular weight of 376.26 g/mol. Its IUPAC name is 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one.
Molecular Properties
| Compound Name | 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one |
| PubChem CID | 166311911 |
| Molecular Formula | C16H18BrN5O |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one |
| SMILES | O=C(C(CCc1ccccc1)c1nn[nH]n1)N1C[C@@H]2C(Br)[C@@H]2C1 |
| InChI | InChI=1S/C16H18BrN5O/c17-14-12-8-22(9-13(12)14)16(23)11(15-18-20-21-19-15)7-6-10-4-2-1-3-5-10/h1-5,11-14H,6-9H2,(H,18,19,20,21)/t11?,12-,13+,14? |
| InChIKey | ZQAPXJPCJMOSJR-AKJUYKBHSA-N |
| XLogP | 1.77 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one?
The IUPAC name of 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one (CID 166311911) is 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one.
What is the SMILES notation for 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one?
The canonical SMILES for 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one is O=C(C(CCc1ccccc1)c1nn[nH]n1)N1C[C@@H]2C(Br)[C@@H]2C1.
What is the InChIKey of 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one?
The InChIKey is ZQAPXJPCJMOSJR-AKJUYKBHSA-N. The full InChI is InChI=1S/C16H18BrN5O/c17-14-12-8-22(9-13(12)14)16(23)11(15-18-20-21-19-15)7-6-10-4-2-1-3-5-10/h1-5,11-14H,6-9H2,(H,18,19,20,21)/t11?,12-,13+,14?.
What are the key properties of 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one?
1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one has a molecular weight of 376.26 g/mol, XLogP of 1.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,5R)-6-bromo-3-azabicyclo[3.1.0]hexan-3-yl]-4-phenyl-2-(2H-tetrazol-5-yl)butan-1-one is sourced from PubChem (CID 166311911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).